CAS 6160-79-8
:4-methyl-2-oxo-2H-chromen-7-yl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside
Description:
4-Methyl-2-oxo-2H-chromen-7-yl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside, with the CAS number 6160-79-8, is a complex organic compound characterized by its chromone and glycoside structures. The chromone moiety contributes to its aromatic properties and potential biological activity, while the glycoside component, derived from beta-D-galactopyranose, indicates that it is a sugar derivative. The presence of multiple acetyl groups suggests that the compound is highly substituted, which can influence its solubility, stability, and reactivity. This compound may exhibit various pharmacological properties, including antioxidant and anti-inflammatory activities, due to the chromone structure. Its synthesis typically involves glycosylation reactions, and it may be used in biochemical studies or as a potential lead compound in drug development. The acetyl groups can also facilitate the compound's solubility in organic solvents, making it useful in various applications in organic chemistry and medicinal chemistry. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and heterocyclic chemistry.
Formula:C24H26O12
InChI:InChI=1/C24H26O12/c1-11-8-20(29)35-18-9-16(6-7-17(11)18)34-24-23(33-15(5)28)22(32-14(4)27)21(31-13(3)26)19(36-24)10-30-12(2)25/h6-9,19,21-24H,10H2,1-5H3/t19-,21+,22+,23-,24-/m1/s1
Synonyms:- 2H-1-Benzopyran-2-one, 4-methyl-7-((2,3,4,6-tetra-O-acetyl-beta-D-galactopyranosyl)oxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Methylumbelliferyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside
CAS:<p>4-Methylumbelliferyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside is a custom synthesis that has been modified with fluorination and methylation. This product is glycosylated and has a complex carbohydrate structure. It can be used for the modification of saccharides or for the synthesis of oligosaccharides and polysaccharides. 4MUF2,3,4,6TetraOAcGalpyr is soluble in water and has a purity of >99%.</p>Formula:C24H26O12Purity:Min. 95%Molecular weight:506.46 g/mol

