CAS 6161-82-6
:2-(2,6-dimethoxyphenoxy)ethanol
Description:
2-(2,6-Dimethoxyphenoxy)ethanol, with the CAS number 6161-82-6, is an organic compound characterized by its ether and alcohol functional groups. It features a phenolic structure with two methoxy groups attached to the aromatic ring, which enhances its solubility in organic solvents and may influence its reactivity. The presence of the hydroxyl (-OH) group in the ethanol moiety contributes to its potential as a hydrogen bond donor, making it useful in various chemical reactions and applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its applications in the synthesis of pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Additionally, the methoxy groups can provide steric hindrance, affecting the compound's reactivity and interaction with other molecules. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H14O4
InChI:InChI=1/C10H14O4/c1-12-8-4-3-5-9(13-2)10(8)14-7-6-11/h3-5,11H,6-7H2,1-2H3
SMILES:COc1cccc(c1OCCO)OC
Synonyms:- Ethanol, 2-(2,6-Dimethoxyphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(2,6-Dimethoxyphenoxy)ethanol
CAS:2-(2,6-Dimethoxyphenoxy)ethanol is a cleavage agent that can be used for the synthesis of lignin model compounds. It is a benzylic ether that is catalyzed by laccase to produce 2,6-dimethoxybenzaldehyde. The compound can be used as a substrate for versicolor or peroxy cleavage reactions. Versicolor cleavage is performed with 1-hydroxybenzotriazole, while peroxy cleavage is performed with hydrogen peroxide. 2-(2,6-Dimethoxyphenoxy)ethanol has been shown to have radical properties and reacts with molecular oxygen and ethanone in the presence of deuterium gas to form 2,6-dimethoxyacetophenone.Formula:C10H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:198.22 g/mol

