CAS 6162-21-6

2-amino-4-{3-[(4-bromophenoxy)methyl]-2,5-dimethylphenyl}-1-(4-methoxyphenyl)-7,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile

Description:

2-amino-4-{3-[(4-bromophenoxy)methyl]-2,5-dimethylphenyl}-1-(4-methoxyphenyl)-7,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile, with CAS number 6162-21-6, is a complex organic compound characterized by its multi-functional structure. It features a hexahydroquinoline core, which contributes to its potential biological activity. The presence of amino, carbonitrile, and methoxy groups suggests that it may exhibit diverse chemical reactivity and potential pharmacological properties. The bromophenoxy and dimethylphenyl substituents enhance its lipophilicity, possibly influencing its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given its structural complexity and the presence of various functional groups that can interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further elucidated through spectroscopic methods and biological assays to assess its efficacy and safety.

Formula: C₃₄H₃₄BrN₃O₃

InChI: InChI=1/C34H34BrN3O3/c1-20-14-22(19-41-26-10-6-23(35)7-11-26)21(2)27(15-20)31-28(18-36)33(37)38(24-8-12-25(40-5)13-9-24)29-16-34(3,4)17-30(39)32(29)31/h6-15,31H,16-17,19,37H2,1-5H3

SMILES: Cc1cc(COc2ccc(cc2)Br)c(C)c(c1)C1C(=C(N)N(c2ccc(cc2)OC)C2=C1C(=O)CC(C)(C)C2)C#N

Benzenesulfonamide, 4-(dimethylamino)- (9CI)

CAS: 6162-21-6

Formula: C₈H₁₂N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.2581

Ref: IN-DA00ELNF

4-(Dimethylamino)benzenesulfonamide

CAS: 6162-21-6

4-(Dimethylamino)benzenesulfonamide

Purity: 98%

Molecular weight: 200.26g/mol

Ref: 54-OR93297

4-(Dimethylamino)benzenesulfonamide

CAS: 6162-21-6

Purity: 98%

Molecular weight: 200.2599945

Ref: 10-F689566

4-(dimethylamino)benzenesulfonamide

Controlled Product

CAS: 6162-21-6

Applications 4-(dimethylamino)benzenesulfonamide (cas# 6162-21-6) is a useful research chemical.

Formula: C₈H₁₂N₂O₂S

Color and Shape: Neat

Molecular weight: 200.26

Ref: TR-B402498

4-(Dimethylamino)benzenesulfonamide

CAS: 6162-21-6

4-(Dimethylamino)benzenesulfonamide is a fluorescent dye used in analytical chemistry. It has been shown to be useful as a solvent for the separation of metal cations and anilines, as well as for the determination of binding constants. The fluorescence spectrum of 4-(dimethylamino)benzenesulfonamide is sensitive to metal cations and anilines, which can be used to determine their concentration. 4-(dimethylamino)benzenesulfonamide has a phenyl ring with amido groups that make it nonpolar, allowing it to dissolve in solvents such as acetonitrile. This molecule also binds to metal cations such as copper and zinc, which allows it to act as a sensor for those metals.

Formula: C₈H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 200.26 g/mol

Ref: 3D-GAA16221