CAS 616204-22-9: Argireline
Description:Argireline, scientifically known as Acetyl Hexapeptide-3, is a synthetic peptide that is often used in cosmetic formulations for its anti-aging properties. It is composed of a chain of six amino acids and is designed to mimic the effects of Botox by inhibiting the release of neurotransmitters that cause muscle contractions, thereby reducing the appearance of fine lines and wrinkles. Argireline is typically soluble in water and has a low molecular weight, which allows for better skin penetration. Its mechanism of action involves the modulation of muscle contractions, leading to a smoother skin texture. Additionally, it is considered safe for topical application and is often included in serums and creams aimed at improving skin elasticity and firmness. While it is not a replacement for medical treatments like Botox, Argireline is popular in the cosmetic industry for its potential to provide a non-invasive alternative for skin rejuvenation.
Formula:C34H60N14O12S
InChI:InChI=1/C34H60N14O12S/c1-17(49)43-20(8-11-25(51)52)29(57)47-22(9-12-26(53)54)31(59)48-23(13-16-61-2)32(60)46-21(7-10-24(35)50)30(58)45-19(6-4-15-42-34(39)40)28(56)44-18(27(36)55)5-3-14-41-33(37)38/h18-23H,3-16H2,1-2H3,(H2,35,50)(H2,36,55)(H,43,49)(H,44,56)(H,45,58)(H,46,60)(H,47,57)(H,48,59)(H,51,52)(H,53,54)(H4,37,38,41)(H4,39,40,42)/t18-,19-,20-,21-,22-,23-/m0/s1
- Synonyms:
- N-Acetyl-L-alpha-glutamyl-L-alpha-glutamyl-L-methionyl-L-glutaminyl-L-arginyl-L-argininamide
- N-acetyl-L-α-glutamyl-L-α-glutamyl-L-methionyl-L-glutaminyl-N5-(diaminomethylidene)-L-ornithyl-N5-(diaminomethylidene)-L-ornithinamide
- Acetyl Hexapeptide-8