CAS 6163-63-9
:tris(2-methylphenyl)phosphane oxide
Description:
Tris(2-methylphenyl)phosphane oxide, with the CAS number 6163-63-9, is an organophosphorus compound characterized by its phosphorus atom bonded to three 2-methylphenyl groups and an oxygen atom, which contributes to its oxidative properties. This compound typically appears as a colorless to pale yellow solid and is known for its stability and solubility in organic solvents. It exhibits significant thermal stability and is often utilized as a ligand in coordination chemistry due to its ability to form complexes with various metal ions. The presence of the phosphane oxide functional group imparts unique reactivity, making it useful in organic synthesis and catalysis. Additionally, tris(2-methylphenyl)phosphane oxide can act as a phosphine oxide in various chemical reactions, including those involving oxidation and coordination. Its applications extend to fields such as materials science and pharmaceuticals, where it may serve as a building block or catalyst in the synthesis of more complex molecules. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C21H21OP
InChI:InChI=1/C21H21OP/c1-16-10-4-7-13-19(16)23(22,20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3
SMILES:Cc1ccccc1P(=O)(c1ccccc1C)c1ccccc1C
Synonyms:- Tri-O-tolylphosphine oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tri-o-tolyl-Phosphine Oxide
CAS:Formula:C21H21OPPurity:95%+Color and Shape:SolidMolecular weight:320.3646Tri-o-tolyl-Phosphine Oxide
CAS:Controlled ProductImpurity Eletriptan Impurity 14
Applications Tri-o-tolyl-Phosphine Oxide (Eletriptan Impurity 14) is an impurity of Eletriptan, a selective serotonin 5-HT1B and 5-HT1D receptor agonist and used to treat migraines.
References Willems, E., et al.: Arch. Pharmacol., 358, 212 (1998); Napier, C., et al.: Eur. J. Pharmacol., 368, 259 (1999); Goadsby, P.J., et al.: Neurology, 54, 156 (2000)Formula:C21H21OPColor and Shape:NeatMolecular weight:320.365



