CAS 61636-28-0: 3-(2-amino-1,3-thiazol-4-yl)-2H-chromen-2-one
Description:3-(2-amino-1,3-thiazol-4-yl)-2H-chromen-2-one, with the CAS number 61636-28-0, is a chemical compound that features a chromenone core substituted with a thiazole ring. This compound typically exhibits characteristics such as being a heterocyclic organic molecule, which may possess biological activity due to the presence of both the thiazole and chromenone moieties. The thiazole ring contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for its possible antimicrobial, anti-inflammatory, or anticancer properties. The amino group on the thiazole enhances its reactivity and solubility in polar solvents. Additionally, the chromenone structure is known for its ability to absorb UV light, which may impart photochemical properties. Overall, this compound's unique structural features suggest a diverse range of applications in pharmaceuticals and materials science, warranting further investigation into its chemical behavior and potential uses.
Formula:C12H8N2O2S
InChI:InChI=1/C12H8N2O2S/c13-12-14-9(6-17-12)8-5-7-3-1-2-4-10(7)16-11(8)15/h1-6H,(H2,13,14)
- Synonyms:
- 2H-1-benzopyran-2-one, 3-(2,3-dihydro-2-imino-4-thiazolyl)-
- 2H-1-Benzopyran-2-one, 3-(2-amino-4-thiazolyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(2-Amino-thiazol-4-yl)-chromen-2-one REF: 10-F030964CAS: 61636-28-0 | 95.0% | To inquire | Fri 22 Aug 25 |
![]() | 3-(2-Amino-thiazol-4-yl)-chromen-2-one REF: 3D-LCA63628CAS: 61636-28-0 | Min. 95% | To inquire | Tue 23 Sep 25 |

Ref: 10-F030964
1g | To inquire | ||
2.5g | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

3-(2-Amino-thiazol-4-yl)-chromen-2-one
Ref: 3D-LCA63628
250mg | 383.00 € | ||
2500mg | 1,092.00 € |