CymitQuimica logo

CAS 61638-01-5

:

4-amino-3-methoxyphenol

Description:
4-Amino-3-methoxyphenol, also known by its IUPAC name, is an organic compound characterized by the presence of an amino group (-NH2) and a methoxy group (-OCH3) attached to a phenolic ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to its functional groups. It exhibits properties typical of phenolic compounds, such as antioxidant activity, and can participate in various chemical reactions, including electrophilic substitution and oxidation. The amino group can act as a nucleophile, while the methoxy group can influence the compound's reactivity and stability. 4-Amino-3-methoxyphenol is often utilized in the synthesis of dyes, pharmaceuticals, and other organic compounds, owing to its functional versatility. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and functional groups make it a valuable compound in both industrial and research applications.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,9H,8H2,1H3
InChI key:SXJQUUPSLJTKKT-UHFFFAOYSA-N
SMILES:COc1cc(ccc1N)O
Synonyms:
  • Phenol, 4-amino-3-methoxy-
Found 4 products.