CAS 6165-69-1
:3-Thienylboronic acid
Description:
3-Thienylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thienyl ring, which is a five-membered aromatic heterocycle containing sulfur. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar solvents like water and alcohols due to the boronic acid group. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in cross-coupling reactions, particularly in the formation of carbon-carbon bonds. The thienyl moiety contributes to its electronic properties, enhancing its reactivity in certain chemical transformations. Additionally, 3-thienylboronic acid can serve as a building block in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Its unique structural features and reactivity make it a valuable compound in both academic research and industrial applications.
Formula:C4H5BO2S
InChI:InChI=1S/C4H5BO2S/c6-5(7)4-1-2-8-3-4/h1-3,6-7H
InChI key:InChIKey=QNMBSXGYAQZCTN-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=CSC1
Synonyms:- (Thiophene-3-yl)boronic acid
- 3-Thienylboronic acid
- 3-Thiopheneboric acid
- 3-Thiophenylboronic acid
- B-3-Thienylboronic acid
- Boronic acid, 3-thienyl-
- Boronic acid, B-3-thienyl-
- Thiophen-3-boronic acid
- Thiophen-3-ylboronic acid
- Thiophene-3-boronic acid
- Thiophenyl-3-Boronic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Thiopheneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C4H5BO2SPurity:97.0 and le 116.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:127.95Thiophene-3-boronic acid
CAS:Formula:C4H5BO2SPurity:98%Color and Shape:Solid, Off-white powderMolecular weight:127.95Thiophene-3-boronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H5BO2SPurity:98%Color and Shape:Powder, White to pale creamMolecular weight:127.95Thiophene-3-boronic acid
CAS:Thiophene-3-boronic acidFormula:C4H5BO2SPurity:≥95%Color and Shape: pale yellow solidMolecular weight:127.96g/mol





