CAS 61657-63-4

3,5-Dibromo-2-(phenylmethoxy)benzaldehyde

Description:

3,5-Dibromo-2-(phenylmethoxy)benzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group and two bromine substituents on the aromatic ring. The presence of the phenylmethoxy group enhances its reactivity and solubility in organic solvents. This compound typically exhibits a pale yellow to light brown appearance and has a moderate molecular weight. Its bromine atoms contribute to its electrophilic properties, making it useful in various chemical reactions, including electrophilic aromatic substitution. The aldehyde functional group allows for further derivatization, making it a valuable intermediate in organic synthesis. Additionally, 3,5-Dibromo-2-(phenylmethoxy)benzaldehyde may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted, as brominated compounds can pose health risks, and appropriate handling and disposal procedures should be followed. Overall, this compound serves as an important building block in the synthesis of more complex organic molecules.

Formula: C₁₄H₁₀Br₂O₂

InChI: InChI=1S/C14H10Br2O2/c15-12-6-11(8-17)14(13(16)7-12)18-9-10-4-2-1-3-5-10/h1-8H,9H2

InChI key: InChIKey=AACUFLFOQQDBBB-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(C=O)C=C(Br)C=C2Br

Synonyms:

• 3,5-Dibromo-2-(phenylmethoxy)benzaldehyde
• Benzaldehyde, 2-(benzyloxy)-3,5-dibromo-
• Benzaldehyde, 3,5-Dibromo-2-(Phenylmethoxy)-
• 2-(Benzyloxy)-3,5-dibromobenzaldehyde

2-(BENZYLOXY)-3,5-DIBROMOBENZALDEHYDE

CAS: 61657-63-4

Formula: C₁₄H₁₀Br₂O₂

Purity: 97%

Molecular weight: 370.0360

Ref: IN-DA00ECND

2-(Benzyloxy)-3,5-dibromobenzaldehyde

CAS: 61657-63-4

2-(Benzyloxy)-3,5-dibromobenzaldehyde

Purity: 97%

Molecular weight: 370.04g/mol

Ref: 54-OR82729

2-(benzyloxy)-3,5-dibromobenzaldehyde

CAS: 61657-63-4

Formula: C₁₄H₁₀Br₂O₂

Purity: 97%

Molecular weight: 370.04

Ref: 10-F425304

2-(benzyloxy)-3,5-dibromobenzaldehyde

CAS: 61657-63-4

2-(Benzyloxy)-3,5-dibromobenzaldehyde (2BDBA) is a carbonyl group with synthons. It is also known as a potential drug candidate for the treatment of cancer and other diseases. The interaction between 2BDBA and the carbonyl group has been investigated with advances in nature, analyses, energies, crystallographic, supramolecular and isomorphous studies. The fingerprint of the compound was found to be different from those of the other similar compounds. The interactions between 2BDBA and other molecules have been studied with advanced analytical techniques such as FTIR spectroscopy, which has given an insight into how these interactions take place.

Formula: C₁₄H₁₀Br₂O₂

Purity: Min. 95%

Molecular weight: 370.04 g/mol

Ref: 3D-LCA65763