CAS 61689-99-4

2-(1-methyl-1H-benzimidazol-2-yl)ethanethioamide

Description:

2-(1-methyl-1H-benzimidazol-2-yl)ethanethioamide, with the CAS number 61689-99-4, is a chemical compound characterized by its unique structural features, which include a benzimidazole moiety and a thioamide functional group. The presence of the benzimidazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The thioamide group enhances its reactivity and can influence its solubility and stability in different environments. This compound may exhibit properties such as moderate polarity, which can affect its interactions in biological systems. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological assays would be of interest for evaluating its efficacy and safety. Overall, 2-(1-methyl-1H-benzimidazol-2-yl)ethanethioamide represents a noteworthy example of a compound with potential utility in various scientific fields.

Formula: C₁₀H₁₁N₃S

InChI: InChI=1/C10H11N3S/c1-13-8-5-3-2-4-7(8)12-10(13)6-9(11)14/h2-5H,6H2,1H3,(H2,11,14)

InChI key: InChIKey=XJXHIQBZWBTMCG-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1CC(N)=S)=CC=CC2

Synonyms:

• 1-Methyl-1H-Benzimidazole-2-ethanethioamide
• 1H-benzimidazole-2-ethanethioamide, 1-methyl-
• 2-(1-Methyl-1H-1,3-benzodiazol-2-yl)ethanethioamide
• 2-(1-Methylbenzimidazol-2-yl)ethanethioamide
• 2-(1-methyl-1H-benzoimidazol-2-yl)-thioacetamide
• 2-(1-Methyl-1H-benzimidazol-2-yl)ethanethioamide

2-(1-Methyl-1H-1,3-benzodiazol-2-yl)ethanethioamide

Controlled Product

CAS: 61689-99-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃S

Purity: Min. 95%

Molecular weight: 205.28 g/mol

Ref: 3D-LCA68999