CAS 61690-08-2

1-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole

Description:

1-Methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole, with the CAS number 61690-08-2, is a chemical compound that belongs to the class of benzimidazoles, which are known for their diverse biological activities. This substance features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring, and is substituted with a methyl group and a thiazole moiety. The presence of the thiazole ring, which contains sulfur and nitrogen, contributes to its potential pharmacological properties. Compounds of this nature are often investigated for their roles in medicinal chemistry, particularly for their antifungal, antibacterial, and anticancer activities. The specific characteristics, such as solubility, melting point, and reactivity, can vary based on the molecular structure and substituents. Additionally, the compound's interactions with biological systems and its mechanism of action would be of interest in research contexts, particularly in drug development and therapeutic applications.

Formula: C₁₃H₁₃N₃S

InChI: InChI=1/C13H13N3S/c1-9-8-17-13(14-9)7-12-15-10-5-3-4-6-11(10)16(12)2/h3-6,8H,7H2,1-2H3

SMILES: Cc1csc(Cc2nc3ccccc3n2C)n1

1-Methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-1,3-benzodiazole

Controlled Product

CAS: 61690-08-2

Versatile small molecule scaffold

Formula: C₁₃H₁₃N₃S

Purity: Min. 95%

Molecular weight: 243.33 g/mol

Ref: 3D-LCA69008