CAS 61695-06-5

1,3-Dihydro-2H-isoindole-2-ethanamine

Description:

1,3-Dihydro-2H-isoindole-2-ethanamine, with the CAS number 61695-06-5, is a chemical compound that belongs to the class of isoindoles, which are bicyclic compounds featuring a fused benzene and pyrrole ring. This substance typically exhibits characteristics such as being a colorless to pale yellow solid or liquid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various bioactive compounds. The presence of an amine functional group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may exhibit basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Its unique structure may also contribute to specific biological activities, making it a subject of interest in research related to neurochemistry and drug design. However, detailed safety and handling information should be consulted, as with any chemical substance.

Formula: C₁₀H₁₄N₂

InChI: InChI=1S/C10H14N2/c11-5-6-12-7-9-3-1-2-4-10(9)8-12/h1-4H,5-8,11H2

InChI key: InChIKey=COFMOMCDQVHTOR-UHFFFAOYSA-N

SMILES: C(CN)N1CC=2C(C1)=CC=CC2

Synonyms:

• 2-(Isoindolin-2-yl)ethanamine
• 1,3-Dihydro-2H-isoindole-2-ethanamine
• 2H-Isoindole-2-ethanamine, 1,3-dihydro-
• 2-(2,3-Dihydro-1H-isoindol-2-yl)ethan-1-amine

2-(2,3-Dihydro-1H-isoindol-2-yl)ethan-1-amine

CAS: 61695-06-5

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂

Purity: Min. 95%

Molecular weight: 162.23 g/mol

Ref: 3D-LCA69506