CAS 61695-63-4

2,6-dihydroxy-4-pentylbenzoic acid

Description:

2,6-Dihydroxy-4-pentylbenzoic acid, with the CAS number 61695-63-4, is an organic compound characterized by its aromatic structure featuring a benzoic acid core substituted with two hydroxyl groups and a pentyl chain. This compound exhibits both acidic and phenolic properties due to the presence of the carboxylic acid and hydroxyl groups, respectively. The hydroxyl groups contribute to its potential for hydrogen bonding, which can influence its solubility in various solvents and its reactivity in chemical reactions. The pentyl chain enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of materials where specific thermal or chemical properties are desired. Additionally, its structural features suggest potential biological activity, which could be explored in pharmaceutical or agrochemical contexts. Overall, 2,6-dihydroxy-4-pentylbenzoic acid is a versatile compound with unique properties stemming from its functional groups and hydrophobic tail.

Formula: C₁₂H₁₆O₄

InChI: InChI=1/C12H16O4/c1-2-3-4-5-8-6-9(13)11(12(15)16)10(14)7-8/h6-7,13-14H,2-5H2,1H3,(H,15,16)

SMILES: CCCCCc1cc(c(c(c1)O)C(=O)O)O

2,6-Dihydroxy-4-pentylbenzoic acid

CAS: 61695-63-4

2,6-Dihydroxy-4-pentylbenzoic acid is a building block for the synthesis of a variety of compounds. It has been used as an intermediate and building block for the synthesis of complex organic compounds. 2,6-Dihydroxy-4-pentylbenzoic acid is also used in research chemical laboratories as a reagent. This chemical has CAS number 61695-63-4 and can be purchased through speciality chemical suppliers.

Formula: C₁₂H₁₆O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 224.25 g/mol

Ref: 3D-FD76773