CAS 61696-54-6

(+)-(18-crown-6)-2,3,11,12-tetracarboxy-lic acid

Description:

(+)-(18-crown-6)-2,3,11,12-tetracarboxylic acid is a complex organic compound that belongs to the class of crown ethers, specifically a derivative of 18-crown-6. This compound features a cyclic structure composed of 18 atoms, including six ether linkages, which provide a unique ability to selectively bind cations, particularly alkali metals. The presence of four carboxylic acid groups in its structure enhances its solubility in polar solvents and increases its ability to form hydrogen bonds, making it a versatile ligand in coordination chemistry. The stereochemistry of the compound is significant, as the (+) designation indicates its specific optical activity, which can influence its interactions with other molecules. This compound is often utilized in various applications, including ion-selective electrodes, extraction processes, and as a building block in supramolecular chemistry. Its ability to form stable complexes with metal ions makes it valuable in analytical chemistry and materials science. Overall, (+)-(18-crown-6)-2,3,11,12-tetracarboxylic acid exemplifies the intricate relationship between molecular structure and function in chemical systems.

Formula: C₁₆H₂₄O₁₄

InChI: InChI=1/C16H24O14/c17-13(18)9-10(14(19)20)29-7-3-26-4-8-30-12(16(23)24)11(15(21)22)28-6-2-25-1-5-27-9/h9-12H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/t9-,10-,11-,12-/m1/s1

SMILES: C1CO[C@H]([C@H](C(=O)O)OCCOCCO[C@H]([C@H](C(=O)O)OCCO1)C(=O)O)C(=O)O

Synonyms:

• (+)-(18-crown-6)-2,3,11,12-Tetracarboxylic Acid
• 1,4,7,10,13,16-Hexaoxacyclooctadecane-2,3,11,12-Tetracarboxylic Acid
• (2R,3R,11R,12R)-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid

(2R,3R,11R,12R)-1,4,7,10,13,16-Hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid

CAS: 61696-54-6

(2R,3R,11R,12R)-1,4,7,10,13,16-Hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid

Purity: ≥95%

Molecular weight: 440.35g/mol

Ref: 54-OR8252T

(+)-(18-Crown-6)-2,3,11,12-tetracarboxylic Acid

Controlled Product

CAS: 61696-54-6

Applications A calcium and barium chelator. A useful chiral NMR discriminating agent for underivatized amino acids.
References Behr., J-P, et al.: Helvetica Chimica Acta., 65 (6), 182, 1853 (1982), Dutton, P.J., et al.: Can. J. Chem., 66, 1097 (1988), Wenzel, T.J., et al.: Tetrahedron Lett., 41, 3769 (2000)

Formula: C₁₆H₂₄O₁₄

Color and Shape: Neat

Molecular weight: 440.35

Ref: TR-C825000