CAS 617-10-7

{[(3-nitrophenyl)carbonyl]amino}acetate

Description:

The chemical substance known as {(3-nitrophenyl)carbonyl]amino}acetate, with the CAS number 617-10-7, is an organic compound characterized by its functional groups and structural features. It contains an amino group, a carbonyl group, and a nitrophenyl moiety, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's acidity and reactivity. This compound is likely to exhibit solubility in polar solvents due to the presence of the amino and acetate groups, which can engage in hydrogen bonding. Its structural complexity suggests potential uses in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. However, handling and usage should be approached with caution, considering the potential toxicity associated with nitro-substituted compounds. Overall, this substance represents a unique combination of functional groups that can lead to diverse chemical behavior and applications.

Formula: C₉H₇N₂O₅

InChI: InChI=1/C9H8N2O5/c12-8(13)5-10-9(14)6-2-1-3-7(4-6)11(15)16/h1-4H,5H2,(H,10,14)(H,12,13)/p-1

SMILES: c1cc(cc(c1)N(=O)=O)C(=NCC(=O)[O-])O

Synonyms:

• glycine, N-(3-nitrobenzoyl)-
• N-(3-nitrobenzoyl)glycine
• N-(3-Nitrobenzoyl)glycine
• 2-[(3-nitrobenzoyl)amino]acetic acid

2-[(3-Nitrophenyl)formamido]acetic acid

CAS: 617-10-7

2-[(3-Nitrophenyl)formamido]acetic acid (2NPA) is a modifying agent that has been used in the modification of carboxyl groups. It can react with nucleophiles to form adducts and with carbodiimides to form ureas. 2NPA reacts with amino acids, peptides, and other nitrogenous compounds at their carboxyl groups to form ester or amide bonds. The nature of the residues after modification varies depending on the nature of the carboxyl group that was modified.

Formula: C₉H₈N₂O₅

Purity: Min. 95%

Molecular weight: 224.17 g/mol

Ref: 3D-AAA61710