CAS 617-57-2
:Lactic acid lactate
Description:
Lactic acid lactate, with the CAS number 617-57-2, is the salt or ester form of lactic acid, typically formed when lactic acid reacts with a base or alcohol. It is commonly found in various biological systems, particularly in muscle metabolism during anaerobic respiration. This compound is characterized by its ability to act as a buffering agent, helping to maintain pH levels in biological fluids. Lactic acid lactate is soluble in water, which facilitates its role in metabolic processes. It is often used in food preservation and as a flavoring agent due to its mild acidity. Additionally, it has applications in the cosmetic industry for its moisturizing properties and in pharmaceuticals as a stabilizer or preservative. The compound is generally recognized as safe when used appropriately, but its concentration and usage should be monitored to avoid potential adverse effects. Overall, lactic acid lactate plays a significant role in both biological and industrial contexts.
Formula:C6H10O5
InChI:InChI=1S/C6H10O5/c1-3(7)6(10)11-4(2)5(8)9/h3-4,7H,1-2H3,(H,8,9)
InChI key:InChIKey=OZZQHCBFUVFZGT-UHFFFAOYSA-N
SMILES:C(OC(C(C)O)=O)(C(O)=O)C
Synonyms:- 2-Lactylic acid
- Propanoic acid, 2-hydroxy-, 1-carboxyethyl ester
- Lactyl lactate
- Lactic acid, bimol. ester
- Lactic acid lactate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
