CAS 617-68-5: Lysine, hydrochloride (1:2)
Description:Lysine hydrochloride (1:2), with the CAS number 617-68-5, is a salt formed from the amino acid lysine and hydrochloric acid. It is a white crystalline powder that is highly soluble in water, making it suitable for various applications in biochemistry and nutrition. As a basic amino acid, lysine plays a crucial role in protein synthesis and is essential for human health, particularly in growth and tissue repair. The hydrochloride form enhances its stability and solubility, facilitating its use in dietary supplements and pharmaceuticals. Lysine hydrochloride is often utilized in formulations to support immune function, promote muscle recovery, and improve overall nutritional status. It is generally recognized as safe when used appropriately, although excessive intake may lead to gastrointestinal disturbances. In laboratory settings, it serves as a standard in amino acid analysis and is also used in cell culture media. Overall, lysine hydrochloride is an important compound in both health and research contexts, reflecting its versatility and significance in biological systems.
Formula:C6H14N2O2·2ClH
InChI:InChI=1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H
InChI key:InChIKey=JBBURJFZIMRPCZ-UHFFFAOYSA-N
SMILES:Cl.O=C(O)C(N)CCCCN
- Synonyms:
- 2,6-Diaminohexanoic acid dihydrochloride
- <span class="text-smallcaps">DL</span>-Lysine, dihydrochloride
- Lysine Dihydrochloride
- Lysine, dihydrochloride, <span class="text-smallcaps">DL</span>-
- Lysine, hydrochloride (1:2)
- Lysinedihydrochloride
- DL-Lysine, dihydrochloride
- Lysine, dihydrochloride, DL-
