CAS 61703-93-3
:8-Ethoxy-2-methylquinoline
Description:
8-Ethoxy-2-methylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of an ethoxy group at the 8-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its hydrophobic nature. It may display fluorescence under certain conditions, making it of interest in various applications, including as a potential fluorescent probe or in organic synthesis. The compound's molecular structure allows for potential interactions with biological systems, which could be explored for pharmaceutical applications. Additionally, its stability and reactivity can be influenced by the substituents on the quinoline ring, making it a subject of interest in medicinal chemistry and materials science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H13NO
InChI:InChI=1S/C12H13NO/c1-3-14-11-6-4-5-10-8-7-9(2)13-12(10)11/h4-8H,3H2,1-2H3
InChI key:InChIKey=IXYZTQJBAJFGKP-UHFFFAOYSA-N
SMILES:O(CC)C=1C2=C(C=CC(C)=N2)C=CC1
Synonyms:- Quinaldine, 8-ethoxy-
- 8-Ethoxyquinaldine
- 8-Ethoxy-2-methylquinoline
- Quinoline, 8-ethoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.