CAS 61711-37-3

4-[2-(ethylamino)ethyl]-2-methyl-5-[(methylsulfanyl)methyl]pyridin-3-ol

Description:

4-[2-(Ethylamino)ethyl]-2-methyl-5-[(methylsulfanyl)methyl]pyridin-3-ol, with the CAS number 61711-37-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of an ethylamino group suggests potential basicity and the ability to form hydrogen bonds, which may influence its solubility and reactivity. The methylsulfanyl group indicates the presence of sulfur, which can impart unique electronic properties and may affect the compound's biological activity. Additionally, the hydroxyl group (-OH) on the pyridine ring contributes to its potential as a ligand in coordination chemistry and may enhance its solubility in polar solvents. The overall molecular structure suggests that this compound could exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific interactions and applications would depend on the context of its use, including potential therapeutic roles or as a precursor in synthetic pathways.

Formula: C₁₂H₂₀N₂OS

InChI: InChI=1/C12H20N2OS/c1-4-13-6-5-11-10(8-16-3)7-14-9(2)12(11)15/h7,13,15H,4-6,8H2,1-3H3

Synonyms:

• 3-Pyridinol, 4-(2-(ethylamino)ethyl)-2-methyl-5-((methylthio)methyl)-
• 4-(2-(Ethylamino)ethyl)-2-methyl-5-((methylthio)methyl)-3-pyridinol

Tamitinol

CAS: 61711-37-3

Tamitinol is a neurotropic drug. It has been found to help symptoms of obsessive rumination in conjunction with maprotiline.

Formula: C₁₂H₂₀N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.37

Ref: TM-T24852