CAS 61756-22-7
:val-gly-ser-glu
Description:
Val-Gly-Ser-Glu, also known by its CAS number 61756-22-7, is a synthetic peptide composed of four amino acids: valine (Val), glycine (Gly), serine (Ser), and glutamic acid (Glu). This peptide exhibits characteristics typical of peptides, including a relatively low molecular weight and the ability to form hydrogen bonds due to the presence of polar side chains. Val-Gly-Ser-Glu may exhibit biological activity, potentially influencing various physiological processes, including cell signaling and metabolism. Its structure allows for flexibility and interaction with other biomolecules, making it of interest in fields such as biochemistry and pharmacology. Peptides like Val-Gly-Ser-Glu can also serve as building blocks for larger proteins or as therapeutic agents. Additionally, the specific sequence of amino acids contributes to its unique properties, including solubility, stability, and reactivity, which can be influenced by environmental factors such as pH and temperature. Overall, Val-Gly-Ser-Glu represents a small but significant component of the vast array of peptides studied in scientific research.
Formula:C15H26N4O8
InChI:InChI=1/C15H26N4O8/c1-7(2)12(16)14(25)17-5-10(21)18-9(6-20)13(24)19-8(15(26)27)3-4-11(22)23/h7-9,12,20H,3-6,16H2,1-2H3,(H,17,25)(H,18,21)(H,19,24)(H,22,23)(H,26,27)
SMILES:CC(C)C(C(=NCC(=NC(CO)C(=NC(CCC(=O)O)C(=O)O)O)O)O)N
Synonyms:- Valylglycylserylglutamic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Val-Gly-Ser-Glu-OH
CAS:Eosinophilic chemotactic tetrapeptide also used as model peptide.Formula:C15H26N4O8Purity:96.6%Color and Shape:Whitish PowderMolecular weight:390.39H-Val-Gly-Ser-Glu-OH
CAS:H-Val-Gly-Ser-Glu-OH is a model system for the study of uptake and distribution of fluorescently labeled peptides. It is made up of four amino acids that are found in various proteins, and also have been shown to be potent inducers of inflammation. H-Val-Gly-Ser-Glu-OH has an acidic side chain and can be cleaved by proteases, which may account for its ability to enhance cell proliferation. H-Val-Gly-Ser-Glu-OH is localized to the epidermal growth factor receptor (EGFR) on the surface membrane of cells and shows chemotactic activity towards hl60 cells, which are human promyelocytic leukemia cells. This peptide also increases light emission from hl60 cells when cultured with monoclonal antibodies against EGFR.
Formula:C15H26N4O8Purity:Min. 95%Color and Shape:PowderMolecular weight:390.39 g/molRef: 3D-FV108801
Discontinued product

