CAS 617706-16-8

1-(5-Chloro-2-fluorophenyl)-2,2,2-trifluoroethanone

Description:

1-(5-Chloro-2-fluorophenyl)-2,2,2-trifluoroethanone, with the CAS number 617706-16-8, is a synthetic organic compound characterized by its unique molecular structure, which includes a trifluoroethanone moiety and a chlorofluorophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The presence of multiple fluorine atoms contributes to its chemical stability and lipophilicity, which can enhance biological activity. Additionally, the chlorine substituent can influence the compound's reactivity and interaction with biological targets. As with many fluorinated compounds, it may exhibit unique properties such as increased volatility and altered solubility compared to non-fluorinated analogs. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₃ClF₄O

InChI: InChI=1S/C8H3ClF4O/c9-4-1-2-6(10)5(3-4)7(14)8(11,12)13/h1-3H

InChI key: InChIKey=NYNRZRXJNHIAJY-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=C(F)C=CC(Cl)=C1

Synonyms:

• 1-(5-Chloro-2-fluorophenyl)-2,2,2-trifluoroethan-1-one
• 1-(5-Chloro-2-fluorophenyl)-2,2,2-trifluoroethanone
• Ethanone, 1-(5-chloro-2-fluorophenyl)-2,2,2-trifluoro-

1-(5-Chloro-2-fluoro-phenyl)-2,2,2-trifluoro-ethanone

CAS: 617706-16-8

Formula: C₈H₃ClF₄O

Purity: 95.0%

Molecular weight: 226.55

Ref: 10-F511100