CAS 61785-35-1: (5-Chloro-2-hydroxyphenyl)(2-chlorophenyl)methanone

Description:(5-Chloro-2-hydroxyphenyl)(2-chlorophenyl)methanone, with the CAS number 61785-35-1, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, specifically a carbonyl group (C=O), attached to a phenyl ring that is further substituted with chlorine and hydroxyl groups. The presence of these substituents contributes to its chemical reactivity and potential biological activity. The compound is likely to exhibit properties typical of chlorinated phenols, such as increased lipophilicity and potential antimicrobial activity. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the hydroxyl group can engage in hydrogen bonding, influencing its solubility and interaction with other molecules. Overall, this compound's unique combination of functional groups and substituents makes it of interest in fields such as medicinal chemistry and materials science, where it may serve as a precursor or active ingredient in various applications.

Formula:C₁₃H₈Cl₂O₂

InChI:InChI=1S/C13H8Cl2O2/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7,16H

InChI key:InChIKey=OSXVZDOVYCTYCW-UHFFFAOYSA-N

SMILES:O=C(C=1C=CC=CC1Cl)C2=CC(Cl)=CC=C2O

Synonyms:
(5-Chloro-2-Hydroxyphenyl)(2-Chlorophenyl)Methanone
2′,5-Dichloro-2-hydroxybenzophenone
Methanone, (5-chloro-2-hydroxyphenyl)(2-chlorophenyl)-
Sl 810196

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2',5-Dichloro-2-hydroxybenzophenone REF: 3B-D4703CAS: 61785-35-1	>98.0%(GC)	38.00 €~122.00 €	Thu 10 Apr 25
2′,5-Dichloro-2-hydroxybenzophenone REF: IN-DA003G9TCAS: 61785-35-1	98%	To inquire	Thu 17 Apr 25
2',5-Dichloro-2-hydroxybenzophenone REF: 54-OR1134CAS: 61785-35-1	98%	32.00 €~3,351.00 €	Mon 21 Apr 25
2',5-Dichloro-2-hydroxybenzophenone REF: 3D-LCA78535CAS: 61785-35-1	Min. 95%	- - -	Discontinued product