CAS 61786-74-1
:(2E)-N-[2-(decylsulfanyl)-1-(hydroxymethyl)ethyl]-3-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)prop-2-enamide
Description:
The chemical substance with the name "(2E)-N-[2-(decylsulfanyl)-1-(hydroxymethyl)ethyl]-3-(6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)prop-2-enamide" and CAS number "61786-74-1" is characterized by its complex molecular structure, which includes multiple functional groups such as an amide, a dioxo tetrahydropyrimidine moiety, and a decylsulfanyl group. This compound features a prop-2-enamide backbone, indicating it has an unsaturated amide functional group, which can contribute to its reactivity and potential biological activity. The presence of a hydroxymethyl group suggests it may participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The decylsulfanyl group adds hydrophobic characteristics, which may affect the compound's lipophilicity and membrane permeability. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, including melting point, solubility, and stability, would require empirical investigation for comprehensive understanding.
Formula:C21H35N3O4S
InChI:InChI=1/C21H35N3O4S/c1-3-4-5-6-7-8-9-10-13-29-15-17(14-25)23-19(26)12-11-18-16(2)22-21(28)24-20(18)27/h11-12,17,25H,3-10,13-15H2,1-2H3,(H,23,26)(H2,22,24,27,28)/b12-11+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC265473
CAS:NSC265473 is an ABCG2 substrate.Formula:C21H35N3O4SColor and Shape:SolidMolecular weight:425.58
