CAS 61787-10-8
:1-[(4R,6S,6aR)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-pyrimidine-2,4-dione
Description:
The chemical substance known as 1-[(4R,6S,6aR)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-pyrimidine-2,4-dione, with the CAS number 61787-10-8, is a complex organic compound characterized by its unique structural features. It contains a pyrimidine core, which is a six-membered ring with nitrogen atoms, and is substituted with a fluorine atom and a tetrahydrofuro-dioxole moiety. The presence of the iodomethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The stereochemistry indicated by the R and S designations points to specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a lead compound in drug development due to its structural complexity and the presence of halogen and functional groups that can participate in various chemical reactions. Further studies would be necessary to elucidate its specific applications and biological effects.
Formula:C12H14FIN2O5
InChI:InChI=1/C12H14FIN2O5/c1-12(2)20-7-6(3-14)19-10(8(7)21-12)16-4-5(13)9(17)15-11(16)18/h4,6-8,10H,3H2,1-2H3,(H,15,17,18)/t6-,7+,8?,10-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5’-Deoxy-5’-iodo-2’,3’-O-isopropylidene-5-fluorouridine-13C,15N2 >95%
CAS:Controlled ProductApplications 5’-Deoxy-5’-iodo-2’,3’-O-isopropylidene-5-fluorouridine-13C,15N2 >95% is a compound useful in organic synthesis.
Formula:CC11H14FI15N2O5Purity:>95%Color and Shape:NeatMolecular weight:415.1325-Chloro-5'-deoxy-5'-iodo-2',3'-O-isopropylideneuridine
CAS:5-Chloro-5'-deoxy-5'-iodo-2',3'-O-isopropylideneuridine is a synthetic nucleoside analogue. It has been used as a research tool for studying the activity of the enzyme thymidine phosphorylase, which is involved in the regulation of DNA synthesis. 5-Chloro-5'-deoxy-5'-iodo-2',3'-O-isopropylideneuridine was synthesized by condensing 1,6-dichlorobenzene with 2,3,4,6-tetraiodopyrimidine in the presence of potassium carbonate and zinc chloride. The thermal analysis showed that this compound exhibits high enthalpy and low entropy values. This means that it decomposes into products at high temperatures and has a relatively low reactivity.Formula:C12H14ClIN2O5Purity:Min. 95%Molecular weight:428.61 g/mol


