CAS 61788-32-7
:Terphenyl, hydrogenated
Description:
Terphenyl, hydrogenated, is a chemical compound derived from the hydrogenation of terphenyl, which consists of three phenyl rings connected by single bonds. This substance is characterized by its high thermal stability and low volatility, making it suitable for use as a heat transfer fluid and in various industrial applications. It is typically a colorless to pale yellow liquid with a high boiling point and low solubility in water, but it is soluble in organic solvents. The hydrogenation process reduces the number of double bonds in the aromatic rings, resulting in a more saturated structure that enhances its stability and reduces reactivity. Terphenyl, hydrogenated, is also known for its excellent electrical insulating properties, making it valuable in electrical applications. Additionally, it has a relatively low toxicity profile, although safety precautions should still be observed when handling the substance. Overall, terphenyl, hydrogenated, is a versatile compound with applications in heat transfer, electrical insulation, and as a component in various chemical formulations.
Formula:Unspecified
InChI:InChI=1/C18H22/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1,3,5,9,11-16H,2,4,6-8,10H2
SMILES:C1=CCC(CC1)c1ccc(cc1)C1C=CCCC1
Synonyms:- Terphenyl, hydrogenated
- Hydrogenated terphenyl
- Terphenyl, partially hydrogenated
- Terphenyls, hydrogenated
- Hydrogenated terphenyls, noniradiated
- 1-Cyclohex-2-En-1-Yl-4-Cyclohex-3-En-1-Ylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Terphenyl Hydrogenated
CAS:<p>Applications Terphenyl hydrogenated (cas# 61788-32-7) is a useful research chemical.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C18H22Color and Shape:Light YellowMolecular weight:238.37Terphenyl hydrogenated
CAS:<p>Plasticizer; heat-transfer medium</p>Purity:Min. 95%Color and Shape:Colorless Clear Liquid
