CAS 61788-44-1
:Phenol, styrenated
Description:
Phenol, styrenated (CAS 61788-44-1) is a synthetic organic compound characterized by the presence of phenolic and styrenic structures. It is primarily used as a polymer additive and stabilizer, enhancing the properties of various materials, particularly in plastics and resins. This substance exhibits good thermal stability and resistance to oxidation, making it suitable for applications that require durability under heat and exposure to environmental factors. Styrenated phenol is typically a viscous liquid or solid, depending on its formulation and processing conditions. It is known for its antioxidant properties, which help in preventing degradation of polymers during processing and in end-use applications. Additionally, it can act as a reactive diluent in certain formulations, improving the flow and application characteristics of coatings and adhesives. Safety considerations include handling precautions due to potential irritant effects on skin and respiratory systems, necessitating appropriate personal protective equipment during use. Overall, phenol, styrenated is valued in industrial applications for its multifunctional properties and effectiveness in enhancing material performance.
Formula:Unspecified
InChI:InChI=1/C10H10O/c1-3-8-5-6-10(11)9(4-2)7-8/h3-7,11H,1-2H2
SMILES:C=Cc1ccc(c(C=C)c1)O
Synonyms:- 2,4-Diethenylphenol
- Antioxidant SP
- Phenol, styrenated
- Styrenated phenol
- Styrenated phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Styrenated phenol
CAS:<p>2,4,6-Tris-(1-phenyl-ethyl)phenol is a phenolic compound that is used to manufacture polyvinyl chloride. It has been shown to be an effective antioxidant and can be used in treatments of polyvinyl chloride products. 2,4,6-Tris-(1-phenyl-ethyl)phenol is hydrophobic and can be used as a coating agent for surfaces that are exposed to water or moisture. 2,4,6-Tris-(1-phenyl-ethyl)phenol has been shown to inhibit the enzymatic reaction between chlorine and hydrophobic compounds. This chemical also has optical properties that are sensitive to changes in pH levels and temperature.</p>Formula:C30H30OPurity:Min. 95%Molecular weight:406.56 g/mol
