CymitQuimica logo

CAS 61792-00-5

:

1,8-Bis(2,4-dinitrophenoxy)-4,5-dinitro-9,10-anthracenedione

Description:
1,8-Bis(2,4-dinitrophenoxy)-4,5-dinitro-9,10-anthracenedione, with CAS number 61792-00-5, is a synthetic organic compound characterized by its complex structure, which includes multiple nitro groups and phenoxy substituents attached to an anthracenedione core. This compound is typically recognized for its vibrant color and potential applications in various fields, including materials science and organic electronics. It exhibits strong electron-accepting properties due to the presence of nitro groups, which can influence its reactivity and interactions with other chemical species. The compound is generally insoluble in water but may dissolve in organic solvents, making it suitable for specific applications in organic synthesis and as a dye. Its stability and reactivity can vary depending on environmental conditions, such as temperature and pH. Safety precautions are essential when handling this compound, as it may pose health risks due to its toxic and potentially explosive nature, particularly in its dry form. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use.
Formula:C26H10N6O16
InChI:InChI=1S/C26H10N6O16/c33-25-21-13(29(39)40)3-7-19(47-17-5-1-11(27(35)36)9-15(17)31(43)44)23(21)26(34)24-20(8-4-14(22(24)25)30(41)42)48-18-6-2-12(28(37)38)10-16(18)32(45)46/h1-10H
InChI key:InChIKey=ZJSTXLBMDBNFRO-UHFFFAOYSA-N
SMILES:O(C1=C2C(C(=O)C=3C(C2=O)=C(OC4=C(N(=O)=O)C=C(N(=O)=O)C=C4)C=CC3N(=O)=O)=C(N(=O)=O)C=C1)C5=C(N(=O)=O)C=C(N(=O)=O)C=C5
Synonyms:
  • 9,10-Anthracenedione, 1,8-bis(2,4-dinitrophenoxy)-4,5-dinitro-
  • 1,8-Bis(2,4-dinitrophenoxy)-4,5-dinitro-9,10-anthracenedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.