CAS 618-30-4

5-Chlorofuran-2-carboxylic acid

Description:

5-Chlorofuran-2-carboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a carboxylic acid functional group (-COOH) at the 2-position and a chlorine atom at the 5-position of the furan ring contributes to its chemical reactivity and properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid group. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in organic synthesis and pharmaceutical applications. The chlorine substituent can influence the compound's reactivity and biological activity, potentially enhancing its properties for specific applications. As with many chlorinated compounds, it is important to handle 5-chlorofuran-2-carboxylic acid with care, considering its potential environmental and health impacts. Overall, this compound serves as a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₅H₂ClO₃

InChI: InChI=1/C5H3ClO3/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8)/p-1

SMILES: c1cc(Cl)oc1C(=O)[O-]

Synonyms:

• 5-Chloro-2-furoic acid
• 5-Chlorofuran-2-Carboxylate

5-Chloro-2-furoic acid

CAS: 618-30-4

5-Chloro-2-furoic acid

Formula: C₅H₃ClO₃

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 146.53g/mol

Ref: 54-OR951451

5-Chlorofuran-2-carboxylic acid

CAS: 618-30-4

Formula: C₅H₃ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.53

Ref: 10-F216631

5-Chlorofuran-2-carboxylic Acid

Controlled Product

CAS: 618-30-4

Formula: C₅H₃ClO₃

Color and Shape: Neat

Molecular weight: 146.53

Ref: TR-C368425

5-Chlorofuran-2-carboxylic acid

CAS: 618-30-4

5-Chlorofuran-2-carboxylic acid is an unlabeled compound that has been found in the chloroacetate fraction of a crude extract of leaves from the plant Garcinia hombroniana. The compound was evaluated for its potential as a bioactive molecule using acetylation, which led to the formation of 5-chlorofuran-2-carboxylic acid methyl ester. This compound was then analysed for its chemical properties, including sequences and parameters. 5-Chlorofuran-2-carboxylic acid methyl ester had no effects on the growth rate of Escherichia coli, but did inhibit the activity of some enzymes involved in DNA replication and repair. Furan, an anion found in 5-chlorofuran-2-carboxylic acid methyl ester, is also present in many other compounds such as 2,4,6 trichlorophenol and 2,5 dichlorophenol

Formula: C₅H₃ClO₃

Purity: Min. 95%

Molecular weight: 146.53 g/mol

Ref: 3D-FC140715