CAS 618-61-1

3-Methyl-5-nitroaniline

Description:

3-Methyl-5-nitroaniline, with the CAS number 618-61-1, is an organic compound belonging to the class of anilines, which are aromatic amines. It features a methyl group and a nitro group attached to a benzene ring, specifically at the 3 and 5 positions, respectively. This compound typically appears as a yellow to orange crystalline solid and is known for its moderate solubility in water, along with better solubility in organic solvents such as ethanol and acetone. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. 3-Methyl-5-nitroaniline is also characterized by its potential toxicity and environmental impact, necessitating careful handling and disposal. Its chemical structure can be represented by the formula C7H8N2O2, and it exhibits properties typical of both aromatic compounds and nitro-substituted anilines, including the ability to undergo electrophilic substitution reactions.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-5-2-6(8)4-7(3-5)9(10)11/h2-4H,8H2,1H3

SMILES: Cc1cc(cc(c1)N(=O)=O)N

Synonyms:

• Benzenamine, 3-Methyl-5-Nitro-

3-METHYL-5-NITRO ANILINE

CAS: 618-61-1

Formula: C₇H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA00EB5A

3-Methyl-5-nitroaniline

CAS: 618-61-1

3-Methyl-5-nitroaniline

Purity: 98%

Molecular weight: 152.15g/mol

Ref: 54-OR903637

3-Methyl-5-nitroaniline

CAS: 618-61-1

Formula: C₇H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 152.153

Ref: 10-F077995