CAS 618-84-8
:3-Amino-5-nitrobenzoic acid
Description:
3-Amino-5-nitrobenzoic acid, with the CAS number 618-84-8, is an organic compound that belongs to the class of amino acids and nitrobenzoic acids. It features an amino group (-NH2) and a nitro group (-NO2) attached to a benzoic acid structure, specifically at the 3 and 5 positions, respectively. This compound is typically a yellow crystalline solid, which is soluble in water and polar organic solvents due to the presence of both the amino and carboxylic acid functional groups. Its molecular formula is C7H6N2O4, and it has a relatively low melting point. The presence of the nitro group contributes to its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in dye production and pharmaceuticals. Additionally, 3-amino-5-nitrobenzoic acid can exhibit biological activity, which may be of interest in medicinal chemistry. Proper handling and safety precautions are necessary due to its potential toxicity and environmental impact.
Formula:C7H5N2O4
InChI:InChI=1/C7H6N2O4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,8H2,(H,10,11)/p-1
SMILES:c1c(cc(cc1N)N(=O)=O)C(=O)[O-]
Synonyms:- 3-Amino-5-nitrobenzoicacid
- Benzoic acid, 3-amino-5-nitro-
- 3-Amino-5-Nitrobenzoate
- 3-Amino-5-nitrobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Amino-5-nitrobenzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6N2O4Purity:98%Color and Shape:Orange to green to brown, PowderMolecular weight:182.143-Amino-5-nitrobenzoic acid
CAS:Formula:C7H6N2O4Purity:95%Color and Shape:SolidMolecular weight:182.13353-Amino-5-nitrobenzoic acid
CAS:3-Amino-5-nitrobenzoic acid is a cyclic analog of diazepam. It has been shown to be an acceptor in the reduction of picric acid and nitro groups. 3-Amino-5-nitrobenzoic acid is a molecule which interacts with dopamine to produce pharmaceutical preparations.Formula:C7H6N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:182.13 g/mol3-Amino-5-nitrobenzoic acid
CAS:Formula:C7H6N2O4Purity:95%Color and Shape:SolidMolecular weight:182.135






