CymitQuimica logo

CAS 61806-76-6

:

N-benzylpentan-2-amine

Description:
N-benzylpentan-2-amine, with the CAS number 61806-76-6, is an organic compound characterized by its amine functional group and a benzyl substituent. It features a pentane backbone with an amine group located at the second carbon, which contributes to its basicity and potential reactivity. The presence of the benzyl group enhances its lipophilicity, allowing it to interact effectively with biological membranes. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It may exhibit moderate solubility in polar solvents due to the amine group while being more soluble in non-polar solvents due to the hydrocarbon chain and benzyl group. N-benzylpentan-2-amine can participate in various chemical reactions, including alkylation and acylation, making it useful in organic synthesis and potentially in pharmaceutical applications. However, safety precautions should be taken when handling this compound, as amines can be irritants and may pose health risks.
Formula:C12H19N
InChI:InChI=1/C12H19N/c1-3-7-11(2)13-10-12-8-5-4-6-9-12/h4-6,8-9,11,13H,3,7,10H2,1-2H3
SMILES:CCCC(C)NCc1ccccc1
Synonyms:
  • benzenemethanamine, N-(1-methylbutyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.