CAS 618070-30-7
:3-Pyrrolidinecarboxylic acid, 1-(4-fluorophenyl)-2-oxo-
Description:
3-Pyrrolidinecarboxylic acid, 1-(4-fluorophenyl)-2-oxo- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a ketone group, contributing to its reactivity and potential biological activity. The presence of the 4-fluorophenyl substituent indicates that it has a fluorine atom attached to a phenyl ring, which can influence its electronic properties and lipophilicity. The molecular structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be affected by the functional groups present, which may also play a role in its interactions with biological targets. Overall, 3-Pyrrolidinecarboxylic acid, 1-(4-fluorophenyl)-2-oxo- is a compound of interest in the field of organic chemistry and drug development, warranting further investigation into its potential applications.
Formula:C11H10FNO3
InChI:InChI=1S/C11H10FNO3/c12-7-1-3-8(4-2-7)13-6-5-9(10(13)14)11(15)16/h1-4,9H,5-6H2,(H,15,16)
InChI key:InChIKey=GKKWONDBUXUCHF-UHFFFAOYSA-N
SMILES:O=C1N(CCC1C(O)=O)C2=CC=C(F)C=C2
Synonyms:- 1-(4-Fluorophenyl)-2-oxopyrrolidine-3-carboxylic acid
- 1-(4-Fluorophenyl)-2-oxo-3-pyrrolidinecarboxylic acid
- 3-Pyrrolidinecarboxylic acid, 1-(4-fluorophenyl)-2-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(4-Fluorophenyl)-2-oxopyrrolidine-3-carboxylic acid
CAS:Formula:C11H10FNO3Molecular weight:223.20041-(4-Fluorophenyl)-2-oxopyrrolidine-3-carboxylic acid
CAS:1-(4-Fluorophenyl)-2-oxopyrrolidine-3-carboxylic acid is a fluorinated derivative of pyrrolidine that is used as a reagent in analytical chemistry. It has been used to develop an electrochemical assay for the detection of microbial infection, which can be used as a rapid diagnostic tool. 1-(4-Fluorophenyl)-2-oxopyrrolidine-3-carboxylic acid has also been shown to inhibit the synthesis of DNA, RNA, and proteins in bacteria. This inhibition may be due to the presence of nitrogen atoms in its structure and diazonium salt formation. 1-(4-Fluorophenyl)-2-oxopyrrolidine-3-carboxylic acid has been tested for use as an antirheumatic drug and shows promising results in animal models. The mechanism by which this drug works is not yet clear but may involve laser abFormula:C11H10FNO3Purity:Min. 95%Molecular weight:223.2 g/mol

