CymitQuimica logo

CAS 618092-28-7

:

{[3,5-bis(trifluoromethyl)phenyl]ethynyl}(trimethyl)silane

Description:
The chemical substance {[3,5-bis(trifluoromethyl)phenyl]ethynyl}(trimethyl)silane, with CAS number 618092-28-7, is an organosilicon compound characterized by the presence of a trimethylsilyl group attached to an ethynyl moiety, which is further substituted with a 3,5-bis(trifluoromethyl)phenyl group. This compound exhibits notable hydrophobicity and thermal stability due to the presence of the trifluoromethyl groups, which enhance its electron-withdrawing properties. The ethynyl linkage contributes to its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and materials science. The presence of the silicon atom provides unique properties, such as increased volatility and potential applications in silicone-based materials. Additionally, the trifluoromethyl groups can impart unique electronic characteristics, making this compound of interest in the development of advanced materials and pharmaceuticals. Overall, its distinctive structure and functional groups make it a valuable compound in both research and industrial applications.
Formula:C13H12F6Si
InChI:InChI=1/C13H12F6Si/c1-20(2,3)5-4-9-6-10(12(14,15)16)8-11(7-9)13(17,18)19/h6-8H,1-3H3
SMILES:C[Si](C)(C)C#Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.