
CAS 618099-01-7
:1-(4-Chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxaldehyde
Description:
1-(4-Chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a chlorophenyl group, and a benzodioxin moiety. This compound typically exhibits properties associated with its functional groups, such as potential reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including condensation and oxidation. The presence of the chlorophenyl group may influence its electronic properties and biological activity, potentially enhancing lipophilicity and modulating interactions with biological targets. Additionally, the benzodioxin structure may contribute to its stability and solubility in organic solvents. This compound is of interest in medicinal chemistry and may have applications in drug development, particularly in the search for new therapeutic agents. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various chemical contexts.
Formula:C18H13ClN2O3
InChI:InChI=1S/C18H13ClN2O3/c19-14-2-4-15(5-3-14)21-10-13(11-22)18(20-21)12-1-6-16-17(9-12)24-8-7-23-16/h1-6,9-11H,7-8H2
InChI key:InChIKey=CSBFNXIMTWXOMD-UHFFFAOYSA-N
SMILES:C(=O)C=1C(=NN(C1)C2=CC=C(Cl)C=C2)C=3C=C4C(=CC3)OCCO4
Synonyms:- 1H-Pyrazole-4-carboxaldehyde, 1-(4-chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-
- 1-(4-Chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.