CAS 6181-08-4

4-butoxy-N-(4-fluoro-3-nitrophenyl)benzamide

Description:

4-butoxy-N-(4-fluoro-3-nitrophenyl)benzamide is an organic compound characterized by its complex structure, which includes a butoxy group, a fluoro-substituted nitrophenyl moiety, and a benzamide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its solubility and reactivity. The presence of the butoxy group enhances its hydrophobic characteristics, while the nitro and fluoro substituents can influence its electronic properties and reactivity, potentially making it a candidate for various chemical reactions or applications in pharmaceuticals and agrochemicals. The compound may also display specific biological activities due to its structural features, which could be of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₇H₁₇FN₂O₄

InChI: InChI=1/C17H17FN2O4/c1-2-3-10-24-14-7-4-12(5-8-14)17(21)19-13-6-9-15(18)16(11-13)20(22)23/h4-9,11H,2-3,10H2,1H3,(H,19,21)

SMILES: CCCCOc1ccc(cc1)C(=O)Nc1ccc(c(c1)N(=O)=O)F

Synonyms:

• benzamide, 4-butoxy-N-(4-fluoro-3-nitrophenyl)-

Ethyl-2-d1 Alcohol

CAS: 6181-08-4

Formula: CH₂DCH₂OH

Purity: 98 atom % D

Color and Shape: Colorless Liquid. Burning Taste

Molecular weight: 47.04814

Ref: 3U-D1103

Ethyl-2-d1 Alcohol

Controlled Product

CAS: 6181-08-4

Applications Ethyl-2-d1 Alcohol (CAS# 6181-08-4) is a useful isotopically labeled research compound.

Formula: C₂H₅DO

Color and Shape: Neat

Molecular weight: 47.08

Ref: TR-E890131