
CAS 61810-55-7
:2-Phenylethyl decanoate
Description:
2-Phenylethyl decanoate, with the CAS number 61810-55-7, is an ester formed from the reaction of 2-phenylethanol and decanoic acid. This compound is characterized by its pleasant floral and fruity aroma, making it a popular choice in the fragrance and flavoring industries. It is a colorless to pale yellow liquid that is typically insoluble in water but soluble in organic solvents. The molecular structure features a phenyl group attached to an ethyl chain, which is further connected to a decanoate group, contributing to its unique properties. 2-Phenylethyl decanoate exhibits moderate volatility and has a relatively low boiling point compared to larger esters. Its applications extend beyond perfumery to include use in cosmetics and food products, where it enhances sensory attributes. Additionally, it is important to handle this compound with care, as with many esters, due to potential skin irritation and other health considerations. Overall, 2-Phenylethyl decanoate is valued for its aromatic qualities and versatility in various formulations.
Formula:C18H28O2
InChI:InChI=1S/C18H28O2/c1-2-3-4-5-6-7-11-14-18(19)20-16-15-17-12-9-8-10-13-17/h8-10,12-13H,2-7,11,14-16H2,1H3
InChI key:InChIKey=DDMQLUJPAGWJOB-UHFFFAOYSA-N
SMILES:C(COC(CCCCCCCCC)=O)C1=CC=CC=C1
Synonyms:- β-Phenylethyl caprate
- Phenethyl caprate
- 2-Phenylethyl decanoate
- Decanoic acid, 2-phenylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenethyl decanoate
CAS:Phenethyl decanoate is a biochemical.Formula:C18H28O2Color and Shape:SolidMolecular weight:276.41
