CAS 618101-64-7
:3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)-1H-pyrazole-4-carboxaldehyde
Description:
3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)-1H-pyrazole-4-carboxaldehyde, with the CAS number 618101-64-7, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a benzodioxin moiety, and a fluorophenyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential reactivity and biological activity. The presence of the aldehyde functional group suggests it may participate in various chemical reactions, such as condensation and oxidation. Additionally, the fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological interactions. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature, which are crucial for its application in research and industry.
Formula:C18H13FN2O3
InChI:InChI=1S/C18H13FN2O3/c19-14-2-4-15(5-3-14)21-10-13(11-22)18(20-21)12-1-6-16-17(9-12)24-8-7-23-16/h1-6,9-11H,7-8H2
InChI key:InChIKey=LPOLOWBCYYQENN-UHFFFAOYSA-N
SMILES:C(=O)C=1C(=NN(C1)C2=CC=C(F)C=C2)C=3C=C4C(=CC3)OCCO4
Synonyms:- 3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)-1H-pyrazole-4-carboxaldehyde
- 1H-Pyrazole-4-carboxaldehyde, 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Fluorophenyl)-3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-1H-pyrazole-4-carbaldehyde
CAS:Molecular weight:324.3110046386719
