CAS 618101-84-1

1-(2,4-Difluorophenyl)-3-(3-pyridinyl)-1H-pyrazole-4-carboxaldehyde

Description:

1-(2,4-Difluorophenyl)-3-(3-pyridinyl)-1H-pyrazole-4-carboxaldehyde, identified by its CAS number 618101-84-1, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a pyridine moiety, and a carboxaldehyde functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the aldehyde group. The difluorophenyl substituent can influence its electronic properties, potentially enhancing its reactivity and interaction with biological targets. The presence of both fluorine atoms and nitrogen-containing rings may contribute to its lipophilicity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structural features suggest potential applications in various fields, including agrochemicals and pharmaceuticals, where it may serve as a lead compound for further modifications and optimization.

Formula: C₁₅H₉F₂N₃O

InChI: InChI=1S/C15H9F2N3O/c16-12-3-4-14(13(17)6-12)20-8-11(9-21)15(19-20)10-2-1-5-18-7-10/h1-9H

InChI key: InChIKey=HDBSWKBJQNALBI-UHFFFAOYSA-N

SMILES: C(=O)C=1C(=NN(C1)C2=C(F)C=C(F)C=C2)C=3C=CC=NC3

Synonyms:

• 1-(2,4-Difluorophenyl)-3-(pyridin-3-yl)-1H-pyrazole-4-carbaldehyde
• 1H-Pyrazole-4-carboxaldehyde, 1-(2,4-difluorophenyl)-3-(3-pyridinyl)-
• 1-(2,4-Difluorophenyl)-3-(3-pyridinyl)-1H-pyrazole-4-carboxaldehyde