CAS 618101-93-2

1-(4-fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid

Description:

1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid, with the CAS number 618101-93-2, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a 4-fluorophenyl group and a phenyl group enhances its lipophilicity and may influence its biological activity. The fluorine atom can also affect the compound's electronic properties, potentially enhancing its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas where pyrazole derivatives have shown efficacy. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrazole ring, making it a versatile candidate for further research and development in various chemical and pharmaceutical applications.

Formula: C₁₆H₁₁FN₂O₂

InChI: InChI=1/C16H11FN2O2/c17-12-6-8-13(9-7-12)19-15(16(20)21)10-14(18-19)11-4-2-1-3-5-11/h1-10H,(H,20,21)

SMILES: c1ccc(cc1)c1cc(C(=O)O)n(c2ccc(cc2)F)n1

1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid

CAS: 618101-93-2

1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid

Purity: ≥95%

Molecular weight: 282.27g/mol

Ref: 54-PC200625

1-(4-Fluoro-phenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid

CAS: 618101-93-2

Formula: C₁₆H₁₁FN₂O₂

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 282.274

Ref: 10-F023816

1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid

Controlled Product

CAS: 618101-93-2

Please enquire for more information about 1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₆H₁₁FN₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 282.27 g/mol

Ref: 3D-FF57111