CAS 61813-58-9

4-Ethoxy-3-methoxybenzyl alcohol

Description:

4-Ethoxy-3-methoxybenzyl alcohol, with the CAS number 61813-58-9, is an organic compound characterized by its aromatic structure and the presence of multiple functional groups. It features a benzene ring substituted with both ethoxy and methoxy groups, which contribute to its solubility and reactivity. The alcohol functional group provides the compound with polar characteristics, making it soluble in polar solvents like water and alcohols. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure allows for potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of more complex molecules. Additionally, the presence of ethoxy and methoxy groups can influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₄O₃

InChI: InChI=1S/C10H14O3/c1-3-13-9-5-4-8(7-11)6-10(9)12-2/h4-6,11H,3,7H2,1-2H3

InChI key: InChIKey=PMSHVORCBMOTBP-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OC)C=C(CO)C=C1

Synonyms:

• (4-Ethoxy-3-Methoxyphenyl)Methanol
• 4-Ethoxy-3-methoxybenzenemethanol
• Benzenemethanol, 4-ethoxy-3-methoxy-
• 4-Ethoxy-3-methoxybenzyl alcohol

4-ETHOXY-3-METHOXYBENZYL ALCOHOL

CAS: 61813-58-9

Formula: C₁₀H₁₄O₃

Purity: 98%

Molecular weight: 182.2164

Ref: IN-DA003LB4

4-Ethoxy-3-methoxybenzyl alcohol

CAS: 61813-58-9

4-Ethoxy-3-methoxybenzyl alcohol

Purity: 99%

Molecular weight: 182.22g/mol

Ref: 54-OR937675

4-Ethoxy-3-methoxybenzyl alcohol

CAS: 61813-58-9

4-Ethoxy-3-methoxybenzyl alcohol is a metabolite of the drug benzocaine. It is formed by hydrolysis of the ester linkages in benzocaine and is then further metabolized to form 4-hydroxy-3-methoxybenzyl alcohol. 4-Ethoxy-3-methoxybenzyl alcohol has been shown to have antinociceptive effects in rats, which may be due to its ability to inhibit pain signals from the peripheral nerves.

Formula: C₁₀H₁₄O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 182.22 g/mol

Ref: 3D-FE70290

4-ETHOXY-3-METHOXYBENZYL ALCOHOL

CAS: 61813-58-9

Formula: C₁₀H₁₄O₃

Purity: 98%

Molecular weight: 182.219

Ref: 10-F470847