CAS 6182-85-0
:2-(benzylsulfanyl)propanoic acid
Description:
2-(Benzylsulfanyl)propanoic acid, with the CAS number 6182-85-0, is an organic compound characterized by the presence of a propanoic acid moiety attached to a benzylsulfanyl group. This compound features a sulfur atom bonded to a benzyl group, which contributes to its unique properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the benzyl group. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C10H12O2S
InChI:InChI=1/C10H12O2S/c1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)
Synonyms:- propanoic acid, 2-[(phenylmethyl)thio]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Benzylthio)propanoic acid
CAS:<p>2-Benzylthiopropanoic acid is a primary alcohol that is an antimicrobial agent. It is a n-oxide, which means it contains the –O–O– group. 2-Benzylthiopropanoic acid has two isomers, alpha and beta. The alpha form has a sulfamic acid group and the beta form has a carboxylic acid group. 2-Benzylthiopropanoic acid can be used to treat gram-negative bacterial infections, such as those caused by Escherichia coli, Klebsiella pneumoniae, Pseudomonas aeruginosa, or Enterobacter cloacae. The most effective way to use this drug is as an aerosol for inhalation therapy in patients with cystic fibrosis or bronchiectasis who have had chronic lung infection. In addition to being an antimicrobial agent, 2-benzylthiopropanoic acid has been shown to have antiinflammatory</p>Formula:C10H12O2SPurity:Min. 95%Molecular weight:196.27 g/mol


