CAS 61820-03-9
:[(2R,3S,4S,5S)-2,4,5-tribenzyloxy-6-(benzyloxymethyl)tetrahydropyran-3-yl] acetate
Description:
The chemical substance with the name "[(2R,3S,4S,5S)-2,4,5-tribenzyloxy-6-(benzyloxymethyl)tetrahydropyran-3-yl] acetate" and CAS number 61820-03-9 is a complex organic compound characterized by its tetrahydropyran structure, which includes multiple benzyloxy groups and an acetate moiety. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its stereochemistry, indicated by the (2R,3S,4S,5S) configuration, suggests specific spatial arrangements of its atoms, which can significantly influence its reactivity and interactions with biological systems. The presence of benzyloxy groups enhances its lipophilicity, potentially affecting its solubility and permeability in various environments. Additionally, the acetate group may confer certain reactivity, making it a useful building block in synthetic chemistry. Overall, this compound exemplifies the intricate nature of organic molecules and their potential applications in pharmaceuticals and materials science.
Formula:C36H38O7
InChI:InChI=1/C36H38O7/c1-27(37)42-35-34(40-24-30-18-10-4-11-19-30)33(39-23-29-16-8-3-9-17-29)32(26-38-22-28-14-6-2-7-15-28)43-36(35)41-25-31-20-12-5-13-21-31/h2-21,32-36H,22-26H2,1H3/t32?,33-,34-,35-,36+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 2-O-Acetyl-3,4,6-Tri-O-benzyl-β-D-galactopyranoside
CAS:Controlled Product<p>Applications Benzyl 2-O-Acetyl-3,4,6-Tri-O-benzyl-β-D-galactopyranoside (cas# 61820-03-9) is a compound useful in organic synthesis.<br></p>Formula:C36H38O7Color and Shape:NeatMolecular weight:582.682-O-Acetyl-1,3,4,6-tetra-O-benzyl-b-D-galactopyranoside
CAS:<p>2-O-Acetyl-1,3,4,6-tetra-O-benzyl-b-D-galactopyranoside is a custom synthesis that belongs to the class of complex carbohydrates. This compound contains a saccharide with a sugar group and is fluorinated at the 2 position. It has been modified by methylation on the C2 position and has an acetyl group on the C3 position.</p>Formula:C36H38O7Purity:Min. 95%Molecular weight:582.68 g/mol


