CAS 61820-04-0
:(2R,3S,4R,5S)-2,4,5-tribenzyloxy-6-(benzyloxymethyl)tetrahydropyran-3-ol
Description:
The chemical substance known as "(2R,3S,4R,5S)-2,4,5-tribenzyloxy-6-(benzyloxymethyl)tetrahydropyran-3-ol," with the CAS number 61820-04-0, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple benzyloxy groups, which are aromatic substituents that enhance its reactivity and solubility in organic solvents. The stereochemistry indicated by the (2R,3S,4R,5S) configuration suggests specific spatial arrangements of the substituents around the chiral centers, which can significantly influence the compound's biological activity and interactions. The presence of hydroxyl (-OH) groups contributes to its potential as a hydrogen bond donor, affecting its solubility and reactivity in various chemical environments. Such compounds are often of interest in medicinal chemistry and organic synthesis due to their structural complexity and potential applications in drug development or as intermediates in chemical reactions.
Formula:C34H36O6
InChI:InChI=1/C34H36O6/c35-31-33(38-23-28-17-9-3-10-18-28)32(37-22-27-15-7-2-8-16-27)30(25-36-21-26-13-5-1-6-14-26)40-34(31)39-24-29-19-11-4-12-20-29/h1-20,30-35H,21-25H2/t30?,31-,32-,33+,34+/m0/s1
Synonyms:- PhenylMethyl 3,4,6-Tris-O-(phenylMethyl)-β-D-galactopyranoside
- 1,3,4,6-Tetra-O-benzyl-b-D-galactopyranoside
- Benzyl 3,4,6-Tri-O-benzyl--D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,3,4,6-Tetra-O-benzyl-b-D-galactopyranoside
CAS:1,3,4,6-Tetra-O-benzyl-b-D-galactopyranoside is a custom synthesis that has been modified with methylation and fluorination. It is an oligosaccharide composed of saccharides linked by glycosidic bonds. Carbohydrates are polymers of monosaccharides, which can be classified as either simple sugars or complex carbohydrates. This product is a high purity, synthetic sugar that is suitable for use in the synthesis of complex carbohydrate polymers.Formula:C34H36O6Purity:Min. 95%Color and Shape:PowderMolecular weight:540.65 g/molBenzyl 3,4,6-Tri-O-benzyl-β-D-galactopyranoside
CAS:Controlled ProductApplications Benzyl 3,4,6-Tri-O-benzyl-β-D-galactopyranoside (cas# 61820-04-0) is a compound useful in organic synthesis.
Formula:C34H36O6Color and Shape:NeatMolecular weight:540.65


