CAS 61826-40-2
:(2-phenylcyclopropyl)methanol
Description:
(2-Phenylcyclopropyl)methanol, with the CAS number 61826-40-2, is an organic compound characterized by its unique cyclopropyl and phenyl functional groups. This compound features a cyclopropane ring, which is a three-membered carbon ring known for its strain and reactivity, bonded to a phenyl group, which is a benzene ring minus one hydrogen atom. The presence of the hydroxymethyl (-CH2OH) group indicates that it is an alcohol, contributing to its potential solubility in polar solvents. The structure of (2-phenylcyclopropyl)methanol suggests it may exhibit interesting chemical reactivity, particularly in reactions involving the cyclopropyl moiety, which can undergo ring-opening reactions under certain conditions. Additionally, the compound may have applications in medicinal chemistry due to the presence of both the cyclopropyl and phenyl groups, which are often found in biologically active molecules. Its physical properties, such as boiling point and melting point, would depend on the specific molecular interactions and the overall structure, but detailed values would require experimental determination.
Formula:C10H12O
InChI:InChI=1/C10H12O/c11-7-9-6-10(9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2
SMILES:c1ccc(cc1)C1CC1CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclopropanemethanol, 2-phenyl-
CAS:Formula:C10H12OPurity:95%Color and Shape:SolidMolecular weight:148.2017(2-Phenylcyclopropyl)methanol
CAS:(2-Phenylcyclopropyl)methanolPurity:95%Molecular weight:148.20g/mol(2-Phenylcyclopropyl)methanol
CAS:Formula:C10H12OPurity:95%Color and Shape:LiquidMolecular weight:148.205(2-Phenylcyclopropyl)methanol
CAS:(2-Phenylcyclopropyl)methanol is an optically pure, chiral reagent that can be used to synthesize cinnamyl alcohols and other enantiomers. (2-Phenylcyclopropyl)methanol has been shown to react with monomers in a cross-linking reaction to produce polymers of various lengths and molecular weights. This compound is also reactive, which means it can be used as a reagent in experiments. It can also be used as an intermediate for the synthesis of other compounds. (2-Phenylcyclopropyl)methanol is sensitive to light, so should be stored in the dark or under inert atmosphere conditions.
Formula:C10H12OPurity:Min. 95%Molecular weight:148.2 g/mol



