CAS 61827-59-6
:1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene
Description:
1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene is an organic compound characterized by its complex aromatic structure, which includes multiple functional groups. It features two bromine atoms, a methoxy group (-OCH3), a methyl group (-CH3), and a nitro group (-NO2) attached to a benzene ring. The presence of these substituents influences its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate solubility in organic solvents due to their aromatic nature, while their reactivity can be attributed to the electrophilic nature of the nitro group and the potential for nucleophilic substitution reactions at the bromine sites. The compound may also display distinct color properties and UV-Vis absorption characteristics, which can be utilized in analytical chemistry. Additionally, the presence of multiple halogens and functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety and handling precautions are essential due to the toxicity associated with brominated compounds and nitro groups.
Formula:C8H7Br2NO3
InChI:InChI=1/C8H7Br2NO3/c1-4-5(9)3-6(11(12)13)8(14-2)7(4)10/h3H,1-2H3
SMILES:Cc1c(cc(c(c1Br)OC)N(=O)=O)Br
Synonyms:- 2,4-Dibromo-3-methyl-6-nitrophenyl methyl ether
- Benzene, 1,3-Dibromo-4-Methoxy-2-Methyl-5-Nitro-
- 1,3-dibromo-4-methoxy-2-methyl-5-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
