CAS 61828-53-3

2-(2-Phenylethyl)chromone

Description:

2-(2-Phenylethyl)chromone, with the CAS number 61828-53-3, is a chemical compound belonging to the chromone family, characterized by a chromone backbone fused with a phenylethyl group. This compound typically exhibits a yellow to light brown color and is known for its aromatic properties due to the presence of the phenyl group. It is often studied for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in medicinal chemistry and pharmacology. The structure of 2-(2-Phenylethyl)chromone includes a chromone ring system, which contributes to its stability and reactivity. Solubility can vary depending on the solvent, but it is generally more soluble in organic solvents than in water. The compound may also exhibit fluorescence, which can be useful in various analytical applications. Overall, 2-(2-Phenylethyl)chromone represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₁₇H₁₄O₂

InChI: InChI=1S/C17H14O2/c18-16-12-14(11-10-13-6-2-1-3-7-13)19-17-9-5-4-8-15(16)17/h1-9,12H,10-11H2

InChI key: InChIKey=VNZNWFQJBFLELF-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC(CCC3=CC=CC=C3)=C1)=CC=CC2

Synonyms:

• 2-(2-Phenylethyl)-4H-1-benzopyran-4-one
• Flindersiachromone
• 2-(2-Phenylethyl)chromone
• 4H-1-Benzopyran-4-one, 2-(2-phenylethyl)-
• Flidersiachromone

2-(2-Phenylethyl)chromone

CAS: 61828-53-3

2-(2-Phenylethyl)chromone

Purity: ≥98%

Molecular weight: 250.29g/mol

Ref: 54-BUP03082

2-(2-Phenylethyl)chromone

CAS: 61828-53-3

2-(2-Phenylethyl)chromone (Flidersiachromone) is a natural product isolated from the herbs of Aquilaria sinensis.

Formula: C₁₇H₁₄O₂

Purity: 98.92%

Color and Shape: Solid

Molecular weight: 250.29

Ref: TM-TN2683

2-(2-Phenylethyl)chromone

CAS: 61828-53-3

2-(2-Phenylethyl)chromone is a bioactive compound classified as an aromatic ketone, prominently found in agarwood, which is derived from the infected heartwood of Aquilaria trees. This compound is primarily formed as a result of oxidative processes initiated when the tree undergoes specific fungal infections, leading to the formation of this high-value resin. The mode of action of 2-(2-Phenylethyl)chromone involves interaction with olfactory receptors, producing a distinctive fragrance that is highly sought after in perfumery.

Formula: C₁₇H₁₄O₂

Purity: Min. 95%

Molecular weight: 250.29 g/mol

Ref: 3D-LCA82853