CAS 6183-01-3
:N-[2-(Benzoylthio)-1-oxopropyl]glycine
Description:
N-[2-(Benzoylthio)-1-oxopropyl]glycine, with the CAS number 6183-01-3, is an organic compound that features a glycine backbone modified with a benzoylthio group. This compound is characterized by its functional groups, which include an amine, a carboxylic acid, and a thioether, contributing to its potential reactivity and biological activity. The presence of the benzoylthio moiety suggests that it may exhibit properties related to thiol reactivity, potentially influencing its interactions in biological systems. The compound's structure allows for hydrogen bonding and dipole interactions, which can affect its solubility and stability in various solvents. Additionally, its molecular configuration may enable it to participate in various chemical reactions, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. As with many compounds containing sulfur and carbonyl functionalities, it may also exhibit unique spectroscopic properties, useful for characterization through techniques such as NMR and IR spectroscopy.
Formula:C12H13NO4S
InChI:InChI=1S/C12H13NO4S/c1-8(11(16)13-7-10(14)15)18-12(17)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,16)(H,14,15)
InChI key:InChIKey=CVAYIPQJWPRFDT-UHFFFAOYSA-N
SMILES:C(SC(C(NCC(O)=O)=O)C)(=O)C1=CC=CC=C1
Synonyms:- Glycine, N-(2-mercaptopropionyl)-, benzoate (ester)
- Glycine, N-[2-(benzoylthio)-1-oxopropyl]-
- Benzoic acid, thio-, S-ester with N-(2-mercaptopropionyl)glycine
- Glycine, N-(2-mercaptopropionyl)-, benzoate
- N-[2-(Benzoylthio)-1-oxopropyl]glycine
- Tiopronin S-Benzoyl Impurity
- Nitroxynil Impurity 2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
S-Benzoyl Tiopronin-d5
CAS:Controlled ProductApplications S-Benzoyl Tiopronin-d5 is labelled S-Benzoyl Tiopronin (B209585) which is used to prepare radiolabeled platelet GPIIb/IIIa receptor antagonists as imaging agents for the diagnosis of thromboembolic disorders.
References DeGrado, W., et al.: PCT Int. Appl., WO 9422494 A1 19941013 (1994)Formula:C12D5H8NO4SColor and Shape:NeatMolecular weight:272.332S-Benzoyl Tiopronin
CAS:Controlled ProductFormula:C12H13NO4SColor and Shape:NeatMolecular weight:267.3

