CAS 61830-23-7

Ethyl 5-bromothiazole-4-carboxylate

Description:

Ethyl 5-bromothiazole-4-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a bromine atom at the 5-position of the thiazole ring contributes to its reactivity and potential applications in organic synthesis. The carboxylate functional group at the 4-position enhances its solubility in polar solvents and allows for further chemical modifications. As an ester, it exhibits typical ester properties, such as being relatively stable under standard conditions but susceptible to hydrolysis in the presence of strong acids or bases. Ethyl 5-bromothiazole-4-carboxylate is often utilized in medicinal chemistry and agrochemical research due to its potential biological activity and ability to serve as a building block for more complex molecules. Its unique structure makes it a valuable compound for the development of pharmaceuticals and other chemical products. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₆H₆BrNO₂S

InChI: InChI=1/C6H6BrNO2S/c1-2-10-6(9)4-5(7)11-3-8-4/h3H,2H2,1H3

SMILES: CCOC(=O)c1c(Br)scn1

Synonyms:

• 5-Bromothiazole-4-carboxylic acid ethyl ester
• Ethyl 5-bromo-1,3-thiazole-4-carboxylate
• Ethyl 5-bromo-4-thiazolecarboxylate

Ethyl 5-bromothiazole-4-carboxylate

CAS: 61830-23-7

Formula: C₆H₆BrNO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.08

Ref: 10-F077994

ethyl 5-bromothiazole-4-carboxylate

CAS: 61830-23-7

Formula: C₆H₆BrNO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.0863

Ref: IN-DA003QHW

Ethyl 5-bromothiazole-4-carboxylate

CAS: 61830-23-7

Ethyl 5-bromothiazole-4-carboxylate

Purity: 97%

Molecular weight: 236.09g/mol

Ref: 54-OR74476