CAS 618382-77-7

1-phenyl-3-thiophen-2-yl-1H-pyrazole-5-carboxylic acid

Description:

1-Phenyl-3-thiophen-2-yl-1H-pyrazole-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole core, which is substituted with a phenyl group and a thiophene ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the thiophene ring imparts unique electronic and structural characteristics, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential interactions with biological targets, which may lead to interesting pharmacological activities. Additionally, the presence of multiple aromatic systems can enhance its stability and solubility in organic solvents. Its CAS number, 618382-77-7, facilitates its identification in chemical databases and regulatory frameworks. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications for research and development in medicinal chemistry and materials science.

Formula: C₁₄H₁₀N₂O₂S

InChI: InChI=1/C14H10N2O2S/c17-14(18)12-9-11(13-7-4-8-19-13)15-16(12)10-5-2-1-3-6-10/h1-9H,(H,17,18)

SMILES: c1ccc(cc1)n1c(cc(c2cccs2)n1)C(=O)O

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 1-phenyl-3-(2-thienyl)-
• 1-Phenyl-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid
• 2-Phenyl-5-thiophen-2-yl-2H-pyrazole-3-carboxylic acid

1-Phenyl-3-thiophen-2-yl-1H-pyrazole-5-carboxylic acid

CAS: 618382-77-7

Color and Shape: Solid

Molecular weight: 270.30999755859375

Ref: 10-F023824