CAS 618382-85-7
:1-(2-methylphenyl)-3-thiophen-2-yl-1H-pyrazole-5-carboxylic acid
Description:
1-(2-Methylphenyl)-3-thiophen-2-yl-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a thiophene moiety, and a carboxylic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and acid-base reactions. The presence of the aromatic rings contributes to its stability and may influence its electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its behavior in different environments. Overall, this compound represents a class of heterocyclic compounds that are valuable in research and development within the fields of organic chemistry and drug discovery.
Formula:C15H12N2O2S
InChI:InChI=1/C15H12N2O2S/c1-10-5-2-3-6-12(10)17-13(15(18)19)9-11(16-17)14-7-4-8-20-14/h2-9H,1H3,(H,18,19)
SMILES:Cc1ccccc1n1c(cc(c2cccs2)n1)C(=O)O
Synonyms:- 1-(2-Methylphenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid
- 1H-Pyrazole-5-carboxylic acid, 1-(2-methylphenyl)-3-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
